Tradlon Chemical Co., Ltd.
Mobile: +86-13367102998
E-mail: xf_sdj001@sina.com
tradlonchem@163.com
Add: 83 Panggong Road, Xiangcheng District, Xiangyang City, Hubei, China
Product
4-Chlorobenzophenone
Name: 4-Chlorobenzophenone
| English name: | 4-Chlorobenzophenone | |
| CAS NO: | 134-85-0 | |
| Molecular weight: | 216.67 | |
| EC NO: | 205-160-7 | |
| Molecular formula: | C13H9ClO | |
| InChI: | InChI=1/C13H9ClO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9H | |
| Alias: | (4-chlorophenyl)(phenyl)methanone; p-Chlorobenzophenone; (4-Chlorophenyl)phenyl-methanone; 4-Chorobenzophenone; p-Chlorodiphenyl ketone; 4-Chlorodiphenyl ketone | |
| Structural formula: | ![]() |
|

