Tradlon Chemical Co., Ltd.
Mobile: +86-13367102998
E-mail: xf_sdj001@sina.com
tradlonchem@163.com
Add: 83 Panggong Road, Xiangcheng District, Xiangyang City, Hubei, China
Product
2,4'-Difluorobenzophenone
Name: 2,4'-Difluorobenzophenone
| English name: | 2,4'-Difluorobenzophenone | |
| CAS NO: | 342-25-6 | |
| Molecular weight: | 236.2654 | |
| EC NO: | 206-441-7 | |
| Molecular formula: | C11H9FN2OS | |
| InChI: | InChI=1/C11H9FN2OS/c12-8-3-1-7(2-4-8)9-6-16-11(14-9)5-10(13)15/h1-4,6H,5H2,(H2,13,15) | |
| Alias: | 2,4'-difluorobenophenone; (2-fluorophenyl)(4-fluorophenyl)methanone | |
| Structural formula: | ![]() |
|

