Tradlon Chemical Co., Ltd.
Mobile: +86-13367102998
E-mail: xf_sdj001@sina.com
tradlonchem@163.com
Add: 83 Panggong Road, Xiangcheng District, Xiangyang City, Hubei, China
Product
2,3,4-Trihydroxybenzophenone
Name: 2,3,4-Trihydroxybenzophenone
| English name: | 2,3,4-Trihydroxybenzophenone | |
| CAS NO: | 1143-72-2 | |
| Molecular weight: | 230.2161 | |
| EC NO: | 214-540-1 | |
| Molecular formula: | C13H10O4 | |
| InChI: | InChI=1/C13H10O4/c14-10-7-6-9(12(16)13(10)17)11(15)8-4-2-1-3-5-8/h1-7,14,16-17H | |
| Alias: | C.I. 57005; Methanone, phenyl(2,3,4-trihydroxyphenyl)-; phenyl(2,3,4-trihydroxyphenyl)methanone; 2,3,4-Triphydroxy benzophenone | |
| Structural formula: | ![]() |
|

