Tradlon Chemical Co., Ltd.
Mobile: +86-13367102998
E-mail: xf_sdj001@sina.com
tradlonchem@163.com
Add: 83 Panggong Road, Xiangcheng District, Xiangyang City, Hubei, China
Product
3,4-Dihydroxybenzophenone
Name: 3,4-Dihydroxybenzophenone
| English name: | 3,4-Dihydroxybenzophenone | |
| CAS NO: | 10425-11-3 | |
| Molecular weight: | 214.2167 | |
| EC NO: | No data | |
| Molecular formula: | C13H10O3 | |
| InChI: | InChI=1/C13H10O3/c14-11-7-6-10(8-12(11)15)13(16)9-4-2-1-3-5-9/h1-8,14-15H | |
| Alias: | 3,4-dihydroxy benzophenone; UV absorber-12; ; (3,4-dihydroxyphenyl)(phenyl)methanone | |
| Structural formula: | ![]() |
|

